C29H39N3O5SSi — CID 59830817
3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-methoxyphenoxy)-1-(2-trimethylsilylethoxymethyl)indole-7-carbonitrile (PubChem CID 59830817) has the molecular formula C29H39N3O5SSi and a molecular weight of 569.80 g/mol. Its IUPAC name is 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-methoxyphenoxy)-1-(2-trimethylsilylethoxymethyl)indole-7-carbonitrile.
| Compound Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-methoxyphenoxy)-1-(2-trimethylsilylethoxymethyl)indole-7-carbonitrile |
|---|---|
| PubChem CID | 59830817 |
| Molecular Formula | C29H39N3O5SSi |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 3-(1-ethylsulfonylpiperidin-4-yl)-5-(4-methoxyphenoxy)-1-(2-trimethylsilylethoxymethyl)indole-7-carbonitrile |
| SMILES | CCS(=O)(=O)N1CCC(c2cn(COCC[Si](C)(C)C)c3c(C#N)cc(Oc4ccc(OC)cc4)cc23)CC1 |
| InChI | InChI=1S/C29H39N3O5SSi/c1-6-38(33,34)32-13-11-22(12-14-32)28-20-31(21-36-15-16-39(3,4)5)29-23(19-30)17-26(18-27(28)29)37-25-9-7-24(35-2)8-10-25/h7-10,17-18,20,22H,6,11-16,21H2,1-5H3 |
| InChIKey | SEZBKEBXRSJEOL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|