C20H22ClN3O2Si — CID 101395267
4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzonitrile (PubChem CID 101395267) has the molecular formula C20H22ClN3O2Si and a molecular weight of 399.95 g/mol. Its IUPAC name is 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzonitrile.
| Compound Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 101395267 |
| Molecular Formula | C20H22ClN3O2Si |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3ccc(C#N)cc3)cc(Cl)nc21 |
| InChI | InChI=1S/C20H22ClN3O2Si/c1-27(2,3)11-10-25-14-24-9-8-17-18(12-19(21)23-20(17)24)26-16-6-4-15(13-22)5-7-16/h4-9,12H,10-11,14H2,1-3H3 |
| InChIKey | HTHSJZTVZHQAAM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|