C14H20ClN3OSi — CID 87223684
2-[(2-chloro-4-ethenylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane (PubChem CID 87223684) has the molecular formula C14H20ClN3OSi and a molecular weight of 309.87 g/mol. Its IUPAC name is 2-[(2-chloro-4-ethenylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-chloro-4-ethenylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 87223684 |
| Molecular Formula | C14H20ClN3OSi |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(2-chloro-4-ethenylpyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C=Cc1nc(Cl)nc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H20ClN3OSi/c1-5-12-11-6-7-18(13(11)17-14(15)16-12)10-19-8-9-20(2,3)4/h5-7H,1,8-10H2,2-4H3 |
| InChIKey | BKJKIQSKSGSYHW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|