C22H30ClN4O2PSi — CID 156755773
2-chloro-N-(2-dimethylphosphoryl-5-ethenylphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156755773) has the molecular formula C22H30ClN4O2PSi and a molecular weight of 477.02 g/mol. Its IUPAC name is 2-chloro-N-(2-dimethylphosphoryl-5-ethenylphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-dimethylphosphoryl-5-ethenylphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156755773 |
| Molecular Formula | C22H30ClN4O2PSi |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-chloro-N-(2-dimethylphosphoryl-5-ethenylphenyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=Cc1ccc(P(C)(C)=O)c(Nc2nc(Cl)nc3c2ccn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C22H30ClN4O2PSi/c1-7-16-8-9-19(30(2,3)28)18(14-16)24-20-17-10-11-27(21(17)26-22(23)25-20)15-29-12-13-31(4,5)6/h7-11,14H,1,12-13,15H2,2-6H3,(H,24,25,26) |
| InChIKey | GLPIMDCDLCOFPS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|