C19H20Cl4N2O2Si — CID 101395266
2-[[6-chloro-4-(2,4,6-trichlorophenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 101395266) has the molecular formula C19H20Cl4N2O2Si and a molecular weight of 478.28 g/mol. Its IUPAC name is 2-[[6-chloro-4-(2,4,6-trichlorophenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-4-(2,4,6-trichlorophenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 101395266 |
| Molecular Formula | C19H20Cl4N2O2Si |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 2-[[6-chloro-4-(2,4,6-trichlorophenoxy)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3c(Cl)cc(Cl)cc3Cl)cc(Cl)nc21 |
| InChI | InChI=1S/C19H20Cl4N2O2Si/c1-28(2,3)7-6-26-11-25-5-4-13-16(10-17(23)24-19(13)25)27-18-14(21)8-12(20)9-15(18)22/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | NYJKJWDYYKYNDG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|