C12H18ClN3OSi — CID 90176933
2-[(5-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane (PubChem CID 90176933) has the molecular formula C12H18ClN3OSi and a molecular weight of 283.83 g/mol. Its IUPAC name is 2-[(5-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90176933 |
| Molecular Formula | C12H18ClN3OSi |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[(5-chloroimidazo[4,5-b]pyridin-3-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc2ccc(Cl)nc21 |
| InChI | InChI=1S/C12H18ClN3OSi/c1-18(2,3)7-6-17-9-16-8-14-10-4-5-11(13)15-12(10)16/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | RRLAQRZOKZEIKG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|