C20H25ClFN3O2Si — CID 163250787
2-[[6-chloro-3-(5-fluoro-2-methoxy-4-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163250787) has the molecular formula C20H25ClFN3O2Si and a molecular weight of 421.98 g/mol. Its IUPAC name is 2-[[6-chloro-3-(5-fluoro-2-methoxy-4-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-3-(5-fluoro-2-methoxy-4-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163250787 |
| Molecular Formula | C20H25ClFN3O2Si |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[[6-chloro-3-(5-fluoro-2-methoxy-4-methyl-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ncc(F)c(C)c1-c1cn(COCC[Si](C)(C)C)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C20H25ClFN3O2Si/c1-13-16(22)10-23-20(26-2)18(13)15-11-25(12-27-8-9-28(3,4)5)19-14(15)6-7-17(21)24-19/h6-7,10-11H,8-9,12H2,1-5H3 |
| InChIKey | HYOFTXNFXCKKLC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|