C20H29N5O3Si — CID 163251023
3-(4,6-dimethoxy-2-methylpyrimidin-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 163251023) has the molecular formula C20H29N5O3Si and a molecular weight of 415.57 g/mol. Its IUPAC name is 3-(4,6-dimethoxy-2-methylpyrimidin-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 3-(4,6-dimethoxy-2-methylpyrimidin-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 163251023 |
| Molecular Formula | C20H29N5O3Si |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-(4,6-dimethoxy-2-methylpyrimidin-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | COc1nc(C)nc(OC)c1-c1cn(COCC[Si](C)(C)C)c2nc(N)ccc12 |
| InChI | InChI=1S/C20H29N5O3Si/c1-13-22-19(26-2)17(20(23-13)27-3)15-11-25(12-28-9-10-29(4,5)6)18-14(15)7-8-16(21)24-18/h7-8,11H,9-10,12H2,1-6H3,(H2,21,24) |
| InChIKey | OMULQJAQHHCOPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|