C21H26N4O2SSi — CID 163251080
3-(6-methoxy-1,3-benzothiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 163251080) has the molecular formula C21H26N4O2SSi and a molecular weight of 426.62 g/mol. Its IUPAC name is 3-(6-methoxy-1,3-benzothiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 3-(6-methoxy-1,3-benzothiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 163251080 |
| Molecular Formula | C21H26N4O2SSi |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-(6-methoxy-1,3-benzothiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | COc1cc2scnc2cc1-c1cn(COCC[Si](C)(C)C)c2nc(N)ccc12 |
| InChI | InChI=1S/C21H26N4O2SSi/c1-26-18-10-19-17(23-12-28-19)9-15(18)16-11-25(13-27-7-8-29(2,3)4)21-14(16)5-6-20(22)24-21/h5-6,9-12H,7-8,13H2,1-4H3,(H2,22,24) |
| InChIKey | CTRMZSOPCUFVFJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|