C15H21IN2O3Si — CID 162383246
methyl 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-6-carboxylate (PubChem CID 162383246) has the molecular formula C15H21IN2O3Si and a molecular weight of 432.33 g/mol. Its IUPAC name is methyl 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-6-carboxylate.
| Compound Name | methyl 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 162383246 |
| Molecular Formula | C15H21IN2O3Si |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | methyl 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(I)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C15H21IN2O3Si/c1-20-15(19)13-6-5-11-12(16)9-18(14(11)17-13)10-21-7-8-22(2,3)4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | FSMNNUZKDHNJAV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|