C11H18N2O5Si — CID 159721123
1-(2-trimethylsilylethoxymethyl)imidazole-2,4-dicarboxylic acid (PubChem CID 159721123) has the molecular formula C11H18N2O5Si and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)imidazole-2,4-dicarboxylic acid.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)imidazole-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 159721123 |
| Molecular Formula | C11H18N2O5Si |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)imidazole-2,4-dicarboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)nc1C(=O)O |
| InChI | InChI=1S/C11H18N2O5Si/c1-19(2,3)5-4-18-7-13-6-8(10(14)15)12-9(13)11(16)17/h6H,4-5,7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | NAAXNXMUFKRVJF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|