C10H18BrN3O2Si — CID 140827014
4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide (PubChem CID 140827014) has the molecular formula C10H18BrN3O2Si and a molecular weight of 320.26 g/mol. Its IUPAC name is 4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide.
| Compound Name | 4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 140827014 |
| Molecular Formula | C10H18BrN3O2Si |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)nc1C(N)=O |
| InChI | InChI=1S/C10H18BrN3O2Si/c1-17(2,3)5-4-16-7-14-6-8(11)13-10(14)9(12)15/h6H,4-5,7H2,1-3H3,(H2,12,15) |
| InChIKey | VQKSDRVSTMTOIQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|