C18H32N4O6Si — CID 170607207
(2S)-3-[2-carbamoyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 170607207) has the molecular formula C18H32N4O6Si and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-3-[2-carbamoyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[2-carbamoyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 170607207 |
| Molecular Formula | C18H32N4O6Si |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-3-[2-carbamoyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cn(COCC[Si](C)(C)C)c(C(N)=O)n1)C(=O)O |
| InChI | InChI=1S/C18H32N4O6Si/c1-18(2,3)28-17(26)21-13(16(24)25)9-12-10-22(15(20-12)14(19)23)11-27-7-8-29(4,5)6/h10,13H,7-9,11H2,1-6H3,(H2,19,23)(H,21,26)(H,24,25)/t13-/m0/s1 |
| InChIKey | CHPURYNAFPOMNQ-ZDUSSCGKSA-N |
| XLogP | 1.81 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|