C23H42N3O5Si- — CID 20872853
5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-propyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pentanoate (PubChem CID 20872853) has the molecular formula C23H42N3O5Si- and a molecular weight of 468.69 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-propyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pentanoate.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-propyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pentanoate |
|---|---|
| PubChem CID | 20872853 |
| Molecular Formula | C23H42N3O5Si- |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-propyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pentanoate |
| SMILES | CCCc1cn(COCC[Si](C)(C)C)c(CC(CCCNC(=O)OC(C)(C)C)C(=O)[O-])n1 |
| InChI | InChI=1S/C23H43N3O5Si/c1-8-10-19-16-26(17-30-13-14-32(5,6)7)20(25-19)15-18(21(27)28)11-9-12-24-22(29)31-23(2,3)4/h16,18H,8-15,17H2,1-7H3,(H,24,29)(H,27,28)/p-1 |
| InChIKey | ZAAMRFYIAFFUPV-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|