C17H28N3O4- — CID 22319388
5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-propylimidazol-4-yl)methyl]pentanoate (PubChem CID 22319388) has the molecular formula C17H28N3O4- and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-propylimidazol-4-yl)methyl]pentanoate.
| Compound Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-propylimidazol-4-yl)methyl]pentanoate |
|---|---|
| PubChem CID | 22319388 |
| Molecular Formula | C17H28N3O4- |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1-propylimidazol-4-yl)methyl]pentanoate |
| SMILES | CCCn1cnc(CC(CCCNC(=O)OC(C)(C)C)C(=O)[O-])c1 |
| InChI | InChI=1S/C17H29N3O4/c1-5-9-20-11-14(19-12-20)10-13(15(21)22)7-6-8-18-16(23)24-17(2,3)4/h11-13H,5-10H2,1-4H3,(H,18,23)(H,21,22)/p-1 |
| InChIKey | RSBLYDDDDLUCLE-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|