C15H25N3O4 — CID 819122
tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]imidazole-1-carboxylate (PubChem CID 819122) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 819122 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCc1cn(C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H25N3O4/c1-14(2,3)21-12(19)16-8-7-11-9-18(10-17-11)13(20)22-15(4,5)6/h9-10H,7-8H2,1-6H3,(H,16,19) |
| InChIKey | WWYWXHQAJQEAQJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |