C15H18N2O4S — CID 147715738
tert-butyl 4-(benzenesulfonylmethyl)imidazole-1-carboxylate (PubChem CID 147715738) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is tert-butyl 4-(benzenesulfonylmethyl)imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(benzenesulfonylmethyl)imidazole-1-carboxylate |
|---|---|
| PubChem CID | 147715738 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | tert-butyl 4-(benzenesulfonylmethyl)imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-15(2,3)21-14(18)17-9-12(16-11-17)10-22(19,20)13-7-5-4-6-8-13/h4-9,11H,10H2,1-3H3 |
| InChIKey | GVOZNIBNLJHYBC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |