C21H23N7O2 — CID 70133251
tert-butyl 4-[2-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]imidazole-1-carboxylate (PubChem CID 70133251) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 70133251 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl 4-[2-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(CCNc2nccc(-n3cnc4ccccc43)n2)c1 |
| InChI | InChI=1S/C21H23N7O2/c1-21(2,3)30-20(29)27-12-15(24-13-27)8-10-22-19-23-11-9-18(26-19)28-14-25-16-6-4-5-7-17(16)28/h4-7,9,11-14H,8,10H2,1-3H3,(H,22,23,26) |
| InChIKey | SWBJTYVSTGYDHG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |