C11H18BrN3O2 — CID 155286322
tert-butyl N-[2-(5-bromo-1-methylpyrazol-3-yl)ethyl]carbamate (PubChem CID 155286322) has the molecular formula C11H18BrN3O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is tert-butyl N-[2-(5-bromo-1-methylpyrazol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-bromo-1-methylpyrazol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 155286322 |
| Molecular Formula | C11H18BrN3O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | tert-butyl N-[2-(5-bromo-1-methylpyrazol-3-yl)ethyl]carbamate |
| SMILES | Cn1nc(CCNC(=O)OC(C)(C)C)cc1Br |
| InChI | InChI=1S/C11H18BrN3O2/c1-11(2,3)17-10(16)13-6-5-8-7-9(12)15(4)14-8/h7H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | ZOCKYMZVRAMFGH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |