C15H22BrNO2 — CID 86697210
tert-butyl N-[2-(4-bromo-3,5-dimethylphenyl)ethyl]carbamate (PubChem CID 86697210) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromo-3,5-dimethylphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-bromo-3,5-dimethylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 86697210 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | tert-butyl N-[2-(4-bromo-3,5-dimethylphenyl)ethyl]carbamate |
| SMILES | Cc1cc(CCNC(=O)OC(C)(C)C)cc(C)c1Br |
| InChI | InChI=1S/C15H22BrNO2/c1-10-8-12(9-11(2)13(10)16)6-7-17-14(18)19-15(3,4)5/h8-9H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | UZFHWQNHIVRXMK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |