C13H18Br2N2O2 — CID 177322011
tert-butyl N-[2-(2,4-dibromo-5-methyl-3-pyridinyl)ethyl]carbamate (PubChem CID 177322011) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is tert-butyl N-[2-(2,4-dibromo-5-methyl-3-pyridinyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,4-dibromo-5-methyl-3-pyridinyl)ethyl]carbamate |
|---|---|
| PubChem CID | 177322011 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | tert-butyl N-[2-(2,4-dibromo-5-methyl-3-pyridinyl)ethyl]carbamate |
| SMILES | Cc1cnc(Br)c(CCNC(=O)OC(C)(C)C)c1Br |
| InChI | InChI=1S/C13H18Br2N2O2/c1-8-7-17-11(15)9(10(8)14)5-6-16-12(18)19-13(2,3)4/h7H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | SBSCFLSKRHQIST-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|