C13H20F3N3O5S — CID 146160675
[1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl] trifluoromethanesulfonate (PubChem CID 146160675) has the molecular formula C13H20F3N3O5S and a molecular weight of 387.38 g/mol. Its IUPAC name is [1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl] trifluoromethanesulfonate.
| Compound Name | [1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146160675 |
| Molecular Formula | C13H20F3N3O5S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl] trifluoromethanesulfonate |
| SMILES | Cn1nc(CCCNC(=O)OC(C)(C)C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O5S/c1-12(2,3)23-11(20)17-7-5-6-9-8-10(19(4)18-9)24-25(21,22)13(14,15)16/h8H,5-7H2,1-4H3,(H,17,20) |
| InChIKey | MEFVMGBKVNQFGR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|