C29H33F3N4O7S — CID 159685194
tert-butyl N-[3-[(4-methoxyquinolin-2-yl)amino]propyl]carbamate;(4-methoxyquinolin-2-yl) trifluoromethanesulfonate (PubChem CID 159685194) has the molecular formula C29H33F3N4O7S and a molecular weight of 638.67 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-methoxyquinolin-2-yl)amino]propyl]carbamate;(4-methoxyquinolin-2-yl) trifluoromethanesulfonate.
| Compound Name | tert-butyl N-[3-[(4-methoxyquinolin-2-yl)amino]propyl]carbamate;(4-methoxyquinolin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159685194 |
| Molecular Formula | C29H33F3N4O7S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | tert-butyl N-[3-[(4-methoxyquinolin-2-yl)amino]propyl]carbamate;(4-methoxyquinolin-2-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(NCCCNC(=O)OC(C)(C)C)nc2ccccc12.COc1cc(OS(=O)(=O)C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C18H25N3O3.C11H8F3NO4S/c1-18(2,3)24-17(22)20-11-7-10-19-16-12-15(23-4)13-8-5-6-9-14(13)21-16;1-18-9-6-10(19-20(16,17)11(12,13)14)15-8-5-3-2-4-7(8)9/h5-6,8-9,12H,7,10-11H2,1-4H3,(H,19,21)(H,20,22);2-6H,1H3 |
| InChIKey | MVRUXFVBTGKRFT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|