C20H21Cl2N3O — CID 44533524
N-(3,4-dichlorophenyl)-N'-(4-methoxyquinolin-2-yl)butane-1,4-diamine (PubChem CID 44533524) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N'-(4-methoxyquinolin-2-yl)butane-1,4-diamine.
| Compound Name | N-(3,4-dichlorophenyl)-N'-(4-methoxyquinolin-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 44533524 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N'-(4-methoxyquinolin-2-yl)butane-1,4-diamine |
| SMILES | COc1cc(NCCCCNc2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H21Cl2N3O/c1-26-19-13-20(25-18-7-3-2-6-15(18)19)24-11-5-4-10-23-14-8-9-16(21)17(22)12-14/h2-3,6-9,12-13,23H,4-5,10-11H2,1H3,(H,24,25) |
| InChIKey | CMSHGYKKCMGVNF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|