C17H24N2O3 — CID 18353658
N-(3,3-diethoxypropyl)-4-methoxyquinolin-2-amine (PubChem CID 18353658) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-4-methoxyquinolin-2-amine.
| Compound Name | N-(3,3-diethoxypropyl)-4-methoxyquinolin-2-amine |
|---|---|
| PubChem CID | 18353658 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(3,3-diethoxypropyl)-4-methoxyquinolin-2-amine |
| SMILES | CCOC(CCNc1cc(OC)c2ccccc2n1)OCC |
| InChI | InChI=1S/C17H24N2O3/c1-4-21-17(22-5-2)10-11-18-16-12-15(20-3)13-8-6-7-9-14(13)19-16/h6-9,12,17H,4-5,10-11H2,1-3H3,(H,18,19) |
| InChIKey | IAAJHZBHRMAKCI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|