C12H21N3O3 — CID 136590022
tert-butyl N-[3-(2-methyl-3-oxo-1H-pyrazol-5-yl)propyl]carbamate (PubChem CID 136590022) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl N-[3-(2-methyl-3-oxo-1H-pyrazol-5-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-methyl-3-oxo-1H-pyrazol-5-yl)propyl]carbamate |
|---|---|
| PubChem CID | 136590022 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl N-[3-(2-methyl-3-oxo-1H-pyrazol-5-yl)propyl]carbamate |
| SMILES | Cn1[nH]c(CCCNC(=O)OC(C)(C)C)cc1=O |
| InChI | InChI=1S/C12H21N3O3/c1-12(2,3)18-11(17)13-7-5-6-9-8-10(16)15(4)14-9/h8,14H,5-7H2,1-4H3,(H,13,17) |
| InChIKey | XHUIYSVSASCZFH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|