C11H17N3O3S — CID 66523332
tert-butyl N-[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethyl]carbamate (PubChem CID 66523332) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is tert-butyl N-[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 66523332 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | tert-butyl N-[2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cc(=O)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H17N3O3S/c1-11(2,3)17-10(16)12-5-4-7-6-8(15)14-9(18)13-7/h6H,4-5H2,1-3H3,(H,12,16)(H2,13,14,15,18) |
| InChIKey | KLWHGVYVJPSTRO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|