C14H25N3O2 — CID 22414662
tert-butyl N-[2-(2-butyl-1H-imidazol-5-yl)ethyl]carbamate (PubChem CID 22414662) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-[2-(2-butyl-1H-imidazol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-butyl-1H-imidazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 22414662 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl N-[2-(2-butyl-1H-imidazol-5-yl)ethyl]carbamate |
| SMILES | CCCCc1ncc(CCNC(=O)OC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H25N3O2/c1-5-6-7-12-16-10-11(17-12)8-9-15-13(18)19-14(2,3)4/h10H,5-9H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | HLSMDKYPHMEPLI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |