C16H30N4O2 — CID 103753203
tert-butyl N-[2-[(2-methyl-1H-imidazol-5-yl)methylamino]hexyl]carbamate (PubChem CID 103753203) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-methyl-1H-imidazol-5-yl)methylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-methyl-1H-imidazol-5-yl)methylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 103753203 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[2-[(2-methyl-1H-imidazol-5-yl)methylamino]hexyl]carbamate |
| SMILES | CCCCC(CNC(=O)OC(C)(C)C)NCc1cnc(C)[nH]1 |
| InChI | InChI=1S/C16H30N4O2/c1-6-7-8-13(9-19-15(21)22-16(3,4)5)18-11-14-10-17-12(2)20-14/h10,13,18H,6-9,11H2,1-5H3,(H,17,20)(H,19,21) |
| InChIKey | HFJPWIBTRWOGGE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |