C16H29N3O2S — CID 107256585
tert-butyl N-[2-[(3-aminothiophen-2-yl)methylamino]hexyl]carbamate (PubChem CID 107256585) has the molecular formula C16H29N3O2S and a molecular weight of 327.49 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-aminothiophen-2-yl)methylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-aminothiophen-2-yl)methylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 107256585 |
| Molecular Formula | C16H29N3O2S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl N-[2-[(3-aminothiophen-2-yl)methylamino]hexyl]carbamate |
| SMILES | CCCCC(CNC(=O)OC(C)(C)C)NCc1sccc1N |
| InChI | InChI=1S/C16H29N3O2S/c1-5-6-7-12(10-19-15(20)21-16(2,3)4)18-11-14-13(17)8-9-22-14/h8-9,12,18H,5-7,10-11,17H2,1-4H3,(H,19,20) |
| InChIKey | FBMZJYISUYXOOJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |