C17H28BrN3O2 — CID 104857007
tert-butyl N-[2-[(5-bromo-3-pyridinyl)methylamino]hexyl]carbamate (PubChem CID 104857007) has the molecular formula C17H28BrN3O2 and a molecular weight of 386.33 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromo-3-pyridinyl)methylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromo-3-pyridinyl)methylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 104857007 |
| Molecular Formula | C17H28BrN3O2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | tert-butyl N-[2-[(5-bromo-3-pyridinyl)methylamino]hexyl]carbamate |
| SMILES | CCCCC(CNC(=O)OC(C)(C)C)NCc1cncc(Br)c1 |
| InChI | InChI=1S/C17H28BrN3O2/c1-5-6-7-15(12-21-16(22)23-17(2,3)4)20-10-13-8-14(18)11-19-9-13/h8-9,11,15,20H,5-7,10,12H2,1-4H3,(H,21,22) |
| InChIKey | JHLAKEFPMQUGGF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |