C16H25Br2N3O2 — CID 107253827
tert-butyl N-[2-[(3,5-dibromo-2-pyridinyl)methylamino]pentyl]carbamate (PubChem CID 107253827) has the molecular formula C16H25Br2N3O2 and a molecular weight of 451.20 g/mol. Its IUPAC name is tert-butyl N-[2-[(3,5-dibromo-2-pyridinyl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3,5-dibromo-2-pyridinyl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 107253827 |
| Molecular Formula | C16H25Br2N3O2 |
| Molecular Weight | 451.20 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | tert-butyl N-[2-[(3,5-dibromo-2-pyridinyl)methylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C16H25Br2N3O2/c1-5-6-12(9-21-15(22)23-16(2,3)4)19-10-14-13(18)7-11(17)8-20-14/h7-8,12,19H,5-6,9-10H2,1-4H3,(H,21,22) |
| InChIKey | BNJJLEMLULEUGK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |