C11H15Br2N3O2 — CID 107237371
tert-butyl N-[(3,5-dibromo-2-pyridinyl)methylamino]carbamate (PubChem CID 107237371) has the molecular formula C11H15Br2N3O2 and a molecular weight of 381.07 g/mol. Its IUPAC name is tert-butyl N-[(3,5-dibromo-2-pyridinyl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(3,5-dibromo-2-pyridinyl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237371 |
| Molecular Formula | C11H15Br2N3O2 |
| Molecular Weight | 381.07 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | tert-butyl N-[(3,5-dibromo-2-pyridinyl)methylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2N3O2/c1-11(2,3)18-10(17)16-15-6-9-8(13)4-7(12)5-14-9/h4-5,15H,6H2,1-3H3,(H,16,17) |
| InChIKey | WPNGLNSVBQXUAU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.07 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|