C15H23BrN2O3 — CID 171562251
tert-butyl N-[[4-bromo-3-(ethoxymethyl)phenyl]methylamino]carbamate (PubChem CID 171562251) has the molecular formula C15H23BrN2O3 and a molecular weight of 359.26 g/mol. Its IUPAC name is tert-butyl N-[[4-bromo-3-(ethoxymethyl)phenyl]methylamino]carbamate.
| Compound Name | tert-butyl N-[[4-bromo-3-(ethoxymethyl)phenyl]methylamino]carbamate |
|---|---|
| PubChem CID | 171562251 |
| Molecular Formula | C15H23BrN2O3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | tert-butyl N-[[4-bromo-3-(ethoxymethyl)phenyl]methylamino]carbamate |
| SMILES | CCOCc1cc(CNNC(=O)OC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C15H23BrN2O3/c1-5-20-10-12-8-11(6-7-13(12)16)9-17-18-14(19)21-15(2,3)4/h6-8,17H,5,9-10H2,1-4H3,(H,18,19) |
| InChIKey | GTSRZBXOKAZEKQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|