C10H14Br2N2O2S — CID 107237310
tert-butyl N-[(4,5-dibromothiophen-2-yl)methylamino]carbamate (PubChem CID 107237310) has the molecular formula C10H14Br2N2O2S and a molecular weight of 386.11 g/mol. Its IUPAC name is tert-butyl N-[(4,5-dibromothiophen-2-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(4,5-dibromothiophen-2-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237310 |
| Molecular Formula | C10H14Br2N2O2S |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | tert-butyl N-[(4,5-dibromothiophen-2-yl)methylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H14Br2N2O2S/c1-10(2,3)16-9(15)14-13-5-6-4-7(11)8(12)17-6/h4,13H,5H2,1-3H3,(H,14,15) |
| InChIKey | DMJHEMKGNYSRKC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|