C16H26BrClN2O2S — CID 107252011
tert-butyl N-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-ethylbutyl]carbamate (PubChem CID 107252011) has the molecular formula C16H26BrClN2O2S and a molecular weight of 425.82 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-ethylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-ethylbutyl]carbamate |
|---|---|
| PubChem CID | 107252011 |
| Molecular Formula | C16H26BrClN2O2S |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | tert-butyl N-[2-[(4-bromo-5-chlorothiophen-2-yl)methylamino]-2-ethylbutyl]carbamate |
| SMILES | CCC(CC)(CNC(=O)OC(C)(C)C)NCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C16H26BrClN2O2S/c1-6-16(7-2,10-19-14(21)22-15(3,4)5)20-9-11-8-12(17)13(18)23-11/h8,20H,6-7,9-10H2,1-5H3,(H,19,21) |
| InChIKey | PRAOTCYOESFRJX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |