C18H32N2O3 — CID 107252008
tert-butyl N-[2-ethyl-2-[(5-ethylfuran-2-yl)methylamino]butyl]carbamate (PubChem CID 107252008) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl N-[2-ethyl-2-[(5-ethylfuran-2-yl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-ethyl-2-[(5-ethylfuran-2-yl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107252008 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl N-[2-ethyl-2-[(5-ethylfuran-2-yl)methylamino]butyl]carbamate |
| SMILES | CCc1ccc(CNC(CC)(CC)CNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C18H32N2O3/c1-7-14-10-11-15(22-14)12-20-18(8-2,9-3)13-19-16(21)23-17(4,5)6/h10-11,20H,7-9,12-13H2,1-6H3,(H,19,21) |
| InChIKey | KEJFMFZGSCWGET-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |