C14H22N2O4 — CID 71995203
tert-butyl N-[[5-[ethyl(methyl)carbamoyl]furan-2-yl]methyl]carbamate (PubChem CID 71995203) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[[5-[ethyl(methyl)carbamoyl]furan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[ethyl(methyl)carbamoyl]furan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71995203 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[[5-[ethyl(methyl)carbamoyl]furan-2-yl]methyl]carbamate |
| SMILES | CCN(C)C(=O)c1ccc(CNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C14H22N2O4/c1-6-16(5)12(17)11-8-7-10(19-11)9-15-13(18)20-14(2,3)4/h7-8H,6,9H2,1-5H3,(H,15,18) |
| InChIKey | OAIINUUOQKSXPZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |