C17H21NO3 — CID 145262667
tert-butyl N-[[5-(2-methylphenyl)furan-2-yl]methyl]carbamate (PubChem CID 145262667) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-[[5-(2-methylphenyl)furan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(2-methylphenyl)furan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 145262667 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl N-[[5-(2-methylphenyl)furan-2-yl]methyl]carbamate |
| SMILES | Cc1ccccc1-c1ccc(CNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C17H21NO3/c1-12-7-5-6-8-14(12)15-10-9-13(20-15)11-18-16(19)21-17(2,3)4/h5-10H,11H2,1-4H3,(H,18,19) |
| InChIKey | BMDSPDJTBYOANO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |