C18H24N2O5 — CID 71995178
tert-butyl N-[[5-[1-(5-methylfuran-2-yl)ethylcarbamoyl]furan-2-yl]methyl]carbamate (PubChem CID 71995178) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl N-[[5-[1-(5-methylfuran-2-yl)ethylcarbamoyl]furan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[1-(5-methylfuran-2-yl)ethylcarbamoyl]furan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71995178 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl N-[[5-[1-(5-methylfuran-2-yl)ethylcarbamoyl]furan-2-yl]methyl]carbamate |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(CNC(=O)OC(C)(C)C)o2)o1 |
| InChI | InChI=1S/C18H24N2O5/c1-11-6-8-14(23-11)12(2)20-16(21)15-9-7-13(24-15)10-19-17(22)25-18(3,4)5/h6-9,12H,10H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | JTAXPMGPLIGEQW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |