C15H26N2O3 — CID 103388158
tert-butyl N-[2-[1-(5-methylfuran-2-yl)ethylamino]propyl]carbamate (PubChem CID 103388158) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(5-methylfuran-2-yl)ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(5-methylfuran-2-yl)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103388158 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl N-[2-[1-(5-methylfuran-2-yl)ethylamino]propyl]carbamate |
| SMILES | Cc1ccc(C(C)NC(C)CNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C15H26N2O3/c1-10(9-16-14(18)20-15(4,5)6)17-12(3)13-8-7-11(2)19-13/h7-8,10,12,17H,9H2,1-6H3,(H,16,18) |
| InChIKey | NGEXIODUROFXQF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |