C18H30N2O2 — CID 107248220
tert-butyl N-[2-[1-(3,4-dimethylphenyl)ethylamino]propyl]carbamate (PubChem CID 107248220) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(3,4-dimethylphenyl)ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(3,4-dimethylphenyl)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107248220 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | tert-butyl N-[2-[1-(3,4-dimethylphenyl)ethylamino]propyl]carbamate |
| SMILES | Cc1ccc(C(C)NC(C)CNC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C18H30N2O2/c1-12-8-9-16(10-13(12)2)15(4)20-14(3)11-19-17(21)22-18(5,6)7/h8-10,14-15,20H,11H2,1-7H3,(H,19,21) |
| InChIKey | BLQBDLTWHLNENY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |