C12H19NO4 — CID 116861139
tert-butyl N-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]carbamate (PubChem CID 116861139) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 116861139 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-(5-methylfuran-2-yl)ethyl]carbamate |
| SMILES | Cc1ccc(C(O)CNC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C12H19NO4/c1-8-5-6-10(16-8)9(14)7-13-11(15)17-12(2,3)4/h5-6,9,14H,7H2,1-4H3,(H,13,15) |
| InChIKey | XLKMNKQFENQKNQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |