C12H18N2O3 — CID 129375181
tert-butyl N-[(2R)-2-hydroxy-2-pyridin-4-ylethyl]carbamate (PubChem CID 129375181) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-hydroxy-2-pyridin-4-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-hydroxy-2-pyridin-4-ylethyl]carbamate |
|---|---|
| PubChem CID | 129375181 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | tert-butyl N-[(2R)-2-hydroxy-2-pyridin-4-ylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](O)c1ccncc1 |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,3)17-11(16)14-8-10(15)9-4-6-13-7-5-9/h4-7,10,15H,8H2,1-3H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | LQGFGQUQXQBBNO-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |