C12H19N3O2 — CID 16732605
tert-butyl N-(1-pyridin-4-ylethylamino)carbamate (PubChem CID 16732605) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-(1-pyridin-4-ylethylamino)carbamate.
| Compound Name | tert-butyl N-(1-pyridin-4-ylethylamino)carbamate |
|---|---|
| PubChem CID | 16732605 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | tert-butyl N-(1-pyridin-4-ylethylamino)carbamate |
| SMILES | CC(NNC(=O)OC(C)(C)C)c1ccncc1 |
| InChI | InChI=1S/C12H19N3O2/c1-9(10-5-7-13-8-6-10)14-15-11(16)17-12(2,3)4/h5-9,14H,1-4H3,(H,15,16) |
| InChIKey | OJRIRVIAYXMZRX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|