C13H18INO3 — CID 51441490
tert-butyl N-[(2S)-2-hydroxy-2-(4-iodophenyl)ethyl]carbamate (PubChem CID 51441490) has the molecular formula C13H18INO3 and a molecular weight of 363.20 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxy-2-(4-iodophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxy-2-(4-iodophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 51441490 |
| Molecular Formula | C13H18INO3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxy-2-(4-iodophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](O)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H18INO3/c1-13(2,3)18-12(17)15-8-11(16)9-4-6-10(14)7-5-9/h4-7,11,16H,8H2,1-3H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | WXKOBXBOCPQQSD-LLVKDONJSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|