C18H32N2O3Si — CID 175783177
tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-4-ylethyl]carbamate (PubChem CID 175783177) has the molecular formula C18H32N2O3Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-4-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-4-ylethyl]carbamate |
|---|---|
| PubChem CID | 175783177 |
| Molecular Formula | C18H32N2O3Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-4-ylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](O[Si](C)(C)C(C)(C)C)c1ccncc1 |
| InChI | InChI=1S/C18H32N2O3Si/c1-17(2,3)22-16(21)20-13-15(14-9-11-19-12-10-14)23-24(7,8)18(4,5)6/h9-12,15H,13H2,1-8H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | OKKAADSEUPQRBW-HNNXBMFYSA-N |
| XLogP | 4.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|