C21H28BrNO2Si — CID 139253351
N-[2-(4-bromophenyl)-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzamide (PubChem CID 139253351) has the molecular formula C21H28BrNO2Si and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzamide.
| Compound Name | N-[2-(4-bromophenyl)-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzamide |
|---|---|
| PubChem CID | 139253351 |
| Molecular Formula | C21H28BrNO2Si |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-[tert-butyl(dimethyl)silyl]oxyethyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC(CNC(=O)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H28BrNO2Si/c1-21(2,3)26(4,5)25-19(16-11-13-18(22)14-12-16)15-23-20(24)17-9-7-6-8-10-17/h6-14,19H,15H2,1-5H3,(H,23,24) |
| InChIKey | AXUWOQIEUXPKQX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|