C27H38O4SSi — CID 23242385
benzyl 4-[1-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-3-oxopropyl]benzoate (PubChem CID 23242385) has the molecular formula C27H38O4SSi and a molecular weight of 486.75 g/mol. Its IUPAC name is benzyl 4-[1-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-3-oxopropyl]benzoate.
| Compound Name | benzyl 4-[1-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 23242385 |
| Molecular Formula | C27H38O4SSi |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | benzyl 4-[1-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-3-oxopropyl]benzoate |
| SMILES | CC(C)(C)SC(=O)CC(O[Si](C)(C)C(C)(C)C)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H38O4SSi/c1-26(2,3)32-24(28)18-23(31-33(7,8)27(4,5)6)21-14-16-22(17-15-21)25(29)30-19-20-12-10-9-11-13-20/h9-17,23H,18-19H2,1-8H3 |
| InChIKey | VIXGAUQUSSSALY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|