C26H38O3SSi — CID 11026896
S-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-phenylmethoxypropanethioate (PubChem CID 11026896) has the molecular formula C26H38O3SSi and a molecular weight of 458.74 g/mol. Its IUPAC name is S-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-phenylmethoxypropanethioate.
| Compound Name | S-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-phenylmethoxypropanethioate |
|---|---|
| PubChem CID | 11026896 |
| Molecular Formula | C26H38O3SSi |
| Molecular Weight | 458.74 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | S-tert-butyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-phenylmethoxypropanethioate |
| SMILES | CC(C)(C)SC(=O)[C@H](OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H38O3SSi/c1-25(2,3)30-24(27)23(28-19-20-15-11-9-12-16-20)22(21-17-13-10-14-18-21)29-31(7,8)26(4,5)6/h9-18,22-23H,19H2,1-8H3/t22-,23-/m1/s1 |
| InChIKey | JYVFIAJSMSRBID-DHIUTWEWSA-N |
| XLogP | 7.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|